Nickel(2+) acetylacetonate structure
|
Common Name | Nickel(2+) acetylacetonate | ||
|---|---|---|---|---|
| CAS Number | 3264-82-2 | Molecular Weight | 256.909 | |
| Density | 0,145 g/cm3 | Boiling Point | 220 °C (11 mmHg) | |
| Molecular Formula | C10H14NiO4 | Melting Point | 230 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | >200°C | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
| Name | Bis(2,4-pentanediono)nickel |
|---|---|
| Synonym | More Synonyms |
| Density | 0,145 g/cm3 |
|---|---|
| Boiling Point | 220 °C (11 mmHg) |
| Melting Point | 230 °C (dec.)(lit.) |
| Molecular Formula | C10H14NiO4 |
| Molecular Weight | 256.909 |
| Flash Point | >200°C |
| Exact Mass | 256.024567 |
| PSA | 52.60000 |
| LogP | 1.92020 |
| Index of Refraction | 1.57-1.64 |
| InChIKey | BMGNSKKZFQMGDH-FDGPNNRMSA-L |
| SMILES | CC(=O)C=C(C)[O-].CC(=O)C=C(C)[O-].[Ni+2] |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H317-H350 |
| Precautionary Statements | P201-P280-P301 + P312 + P330-P308 + P313 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22;R40;R43 |
| Safety Phrases | 53-36/37/39-45-36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | SA2100000 |
| HS Code | 29420000 |
|
~%
Nickel(2+) acet... CAS#:3264-82-2 |
| Literature: Thermochimica Acta, , vol. 178, p. 241 - 248 |
|
~%
Nickel(2+) acet... CAS#:3264-82-2 |
| Literature: Organometallics, , vol. 29, # 21 p. 5098 - 5102 |
|
~%
Nickel(2+) acet... CAS#:3264-82-2 |
| Literature: Journal of the Indian Chemical Society, , vol. 59, # 6 p. 715 - 722 |
| Precursor 5 | |
|---|---|
| DownStream 9 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Synthesis and Structural Evolution of Nickel-Cobalt Nanoparticles Under H2 and CO2.
Small 11 , 3045-53, (2015) Bimetallic nanoparticle (NP) catalysts are interesting for the development of selective catalysts in reactions such as the reduction of CO2 by H2 to form hydrocarbons. Here the synthesis of Ni-Co NPs ... |
|
|
Effect of component distribution and nanoporosity in CuPt nanotubes on electrocatalysis of the oxygen reduction reaction.
ChemSusChem 8(3) , 486-94, (2015) Pt-based bimetallic electrocatalysts hold great potential in the oxygen reduction reaction (ORR) in current fuel-cell prototypes. However, they also face challenges from drastic dealloying of less-nob... |
|
|
Ni3C-assisted growth of carbon nanofibres 300 °C by thermal CVD.
Nanotechnology 25(32) , 325602, (2014) Ni-assisted thermal chemical vapor deposition (TCVD) is one of the most common techniques for the growth of carbon nanofibres/nanotubes (CNFs/CNTs). However, some fundamental issues related to the cat... |
| Nickel(II) Acetylacetonate |
| anhydrous nickel acetylacetonate |
| 3-Penten-2-one, 4-hydroxy-, nickel(2+) salt, (3Z)- (2:1) |
| Acetylacetonenickel |
| Nickel bis(acetylacetonate) |
| 2,4-Pentanedione nickel(II) derivative |
| NICKEL PENTANEDIONATE |
| NICKEL ACETYLACETONATE |
| EINECS 221-875-7 |
| Nickel(2+) bis[(2Z)-4-oxo-2-penten-2-olate] |
| MFCD00000024 |
| Acetylacetonate nickel |
| Nickel(2+) bis[(2Z)-4-oxopent-2-en-2-olate] |
| Bis(acetylacetonato)nickel(II) |
| Nickel(2+) acetylacetonate |
| Acetylacetonato nickel |
| Bis(2,4-pentanedionato)nickel(II) |
| Nickel acetonylacetonate |