ethyl 2-methyl-4,5,6,7-tetrafluorobenzofuran-3-carboxylate structure
|
Common Name | ethyl 2-methyl-4,5,6,7-tetrafluorobenzofuran-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 3265-71-2 | Molecular Weight | 276.18400 | |
| Density | 1.424g/cm3 | Boiling Point | 295.9ºC at 760 mmHg | |
| Molecular Formula | C12H8F4O3 | Melting Point | 69-70°C | |
| MSDS | N/A | Flash Point | 132.8ºC | |
| Name | ethyl 4,5,6,7-tetrafluoro-2-methyl-1-benzofuran-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.424g/cm3 |
|---|---|
| Boiling Point | 295.9ºC at 760 mmHg |
| Melting Point | 69-70°C |
| Molecular Formula | C12H8F4O3 |
| Molecular Weight | 276.18400 |
| Flash Point | 132.8ºC |
| Exact Mass | 276.04100 |
| PSA | 39.44000 |
| LogP | 3.47430 |
| Index of Refraction | 1.506 |
| InChIKey | FLVYOTVMIFECHQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)oc2c(F)c(F)c(F)c(F)c12 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Ethyl 2-methyl-4,5,6,7-tetrafluorobenzofuran-3-carboxylate |
| MFCD00085082 |
| F0792-0010 |
| ethyl 4,5,6,7-tetrakis(fluoranyl)-2-methyl-1-benzofuran-3-carboxylate |
| 4,5,6,7-tetrafluoro-2-methyl-3-benzofurancarboxylic acid ethyl ester |
| 3-Aethoxycarbonyl-4,5,6,7-tetrafluor-2-methyl-cumaron |
| 4,5,6,7-tetrafluoro-2-methyl-benzofuran-3-carboxylic acid ethyl ester |