2,4-bis(trifluoromethyl)chlorobenzene
2,4-bis(trifluoromethyl)chlorobenzene structure
|
Common Name | 2,4-bis(trifluoromethyl)chlorobenzene | ||
|---|---|---|---|---|
| CAS Number | 327-76-4 | Molecular Weight | 248.55300 | |
| Density | 1,52 g/cm3 | Boiling Point | 150 °C | |
| Molecular Formula | C8H3ClF6 | Melting Point | -59--58°C | |
| MSDS | N/A | Flash Point | 59°C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-chloro-2,4-bis(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1,52 g/cm3 |
|---|---|
| Boiling Point | 150 °C |
| Melting Point | -59--58°C |
| Molecular Formula | C8H3ClF6 |
| Molecular Weight | 248.55300 |
| Flash Point | 59°C |
| Exact Mass | 247.98300 |
| LogP | 4.37760 |
| Index of Refraction | 1.4140 |
| InChIKey | XIVDTLKMHDHQCB-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(Cl)c(C(F)(F)F)c1 |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant;F: Flammable; |
|---|---|
| Risk Phrases | R10;R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | UN1993 |
| Packaging Group | III |
| Hazard Class | 3 |
| HS Code | 2903999090 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD01631638 |
| 2,4-bis(trifluoromethyl)-1-chlorobenzene |
| 2,4-bis-(trifluoromethyl)chlorobenzene |
| 1-chloro-2,4-bis-trifluoromethyl-benzene |
| 2,3-DIMETHYL-5-[(1E)-PENT-1-EN-1-YL]PYRAZINE |
| 4-chloro-1,3-bis-(trifluoromethyl)-benzene |
| 1-Chlor-2.4-bis-<trifluormethyl>-benzol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-chloro-2,4-bis(trifluoromethyl)benzene? |
| A: SMILES notation of 1-chloro-2,4-bis(trifluoromethyl)benzene is FC(F)(F)c1ccc(Cl)c(C(F)(F)F)c1. |
| Q: What English synonyms does 1-chloro-2,4-bis(trifluoromethyl)benzene have? |
| A: English synonyms of 1-chloro-2,4-bis(trifluoromethyl)benzene: MFCD01631638, 2,4-bis(trifluoromethyl)-1-chlorobenzene, 2,4-bis-(trifluoromethyl)chlorobenzene, 1-chloro-2,4-bis-trifluoromethyl-benzene, 2,3-DIMETHYL-5-[(1E)-PENT-1-EN-1-YL]PYRAZINE, 4-chloro-1,3-bis-(trifluoromethyl)-benzene, 1-Chlor-2.4-bis--benzol. |
| Q: What is the boiling point of 1-chloro-2,4-bis(trifluoromethyl)benzene? |
| A: Boiling point of 1-chloro-2,4-bis(trifluoromethyl)benzene is 150 °C. |
| Q: What is the melting point of 1-chloro-2,4-bis(trifluoromethyl)benzene? |
| A: Melting point of 1-chloro-2,4-bis(trifluoromethyl)benzene is -59--58°C. |
| Q: What is the English name of 1-chloro-2,4-bis(trifluoromethyl)benzene? |
| A: The English name of 1-chloro-2,4-bis(trifluoromethyl)benzene is 1-chloro-2,4-bis(trifluoromethyl)benzene. |
| Q: What are the storage conditions for 1-chloro-2,4-bis(trifluoromethyl)benzene? |
| A: Storage conditions for 1-chloro-2,4-bis(trifluoromethyl)benzene: 2-8°C. |
| Q: What is the safety information for 1-chloro-2,4-bis(trifluoromethyl)benzene? |
| A: Safety information for 1-chloro-2,4-bis(trifluoromethyl)benzene: S26-S36/37/39. |
| Q: What is the InChIKey of 1-chloro-2,4-bis(trifluoromethyl)benzene? |
| A: InChIKey of 1-chloro-2,4-bis(trifluoromethyl)benzene is XIVDTLKMHDHQCB-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-chloro-2,4-bis(trifluoromethyl)benzene? |
| A: Molecular formula of 1-chloro-2,4-bis(trifluoromethyl)benzene is C8H3ClF6. |
| Q: What is the molecular weight of 1-chloro-2,4-bis(trifluoromethyl)benzene? |
| A: Molecular weight of 1-chloro-2,4-bis(trifluoromethyl)benzene is 248.55300. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |