2-(cis-4-((tert-Butoxycarbonyl)amino)cyclohexyl)acetic acid structure
|
Common Name | 2-(cis-4-((tert-Butoxycarbonyl)amino)cyclohexyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 327156-95-6 | Molecular Weight | 257.326 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 414.9±14.0 °C at 760 mmHg | |
| Molecular Formula | C13H23NO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 204.7±20.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Boc-cis-4-aminocyclohexane acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 414.9±14.0 °C at 760 mmHg |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.326 |
| Flash Point | 204.7±20.1 °C |
| Exact Mass | 257.162720 |
| PSA | 75.63000 |
| LogP | 2.10 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | IHXBNSUFUFFBRL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CC(=O)O)CC1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| RIDADR | NONH for all modes of transport |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| fmoc-cis-1,4-aminocyclohexyl acetic acid |
| [cis-4-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)cyclohexyl]acetic acid |
| Cyclohexaneacetic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-, cis- |