Tricin 7-O-glucoside structure
|
Common Name | Tricin 7-O-glucoside | ||
|---|---|---|---|---|
| CAS Number | 32769-01-0 | Molecular Weight | 492.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H24O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tricin 7-O-glucosideTricin 7-O-β-D-glucopyranoside is a potent and orally active neuroprotective agent. Tricin 7-O-β-D-glucopyranoside induces Apoptosis. Tricin 7-O-β-D-glucopyranoside decreases the expression of TNF-α induced phosphor-κB-α, phosphor-NF-κB, HMGB1[1]. |
| Name | tricin-7-β-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | Tricin 7-O-β-D-glucopyranoside is a potent and orally active neuroprotective agent. Tricin 7-O-β-D-glucopyranoside induces Apoptosis. Tricin 7-O-β-D-glucopyranoside decreases the expression of TNF-α induced phosphor-κB-α, phosphor-NF-κB, HMGB1[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C23H24O12 |
|---|---|
| Molecular Weight | 492.43 |
| Exact Mass | 492.12700 |
| PSA | 188.51000 |
| LogP | 0.06710 |
| InChIKey | JGXFMIJHKASCIZ-LDBVRRDLSA-N |
| SMILES | COc1cc(-c2cc(=O)c3c(O)cc(OC4OC(CO)C(O)C(O)C4O)cc3o2)cc(OC)c1O |
| morifonoside A |
| 5,4'-dihydroxy-3',5'-dimethoxy-7-O-β-D-glucopyranosylflavone |
| 5-Hydroxy-2-(4-hydroxy-3,5-dimethoxy-phenyl)-7-((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-hydroxymethyl-tetrahydro-pyran-2-yloxy)-chromen-4-one |
| 4',5-dihydroxy-3',5'-dimethoxyflavone 7-O-β-D-glucoside |
| 3',5'-dimethoxytricetin-7-O-β-D-glucopyranoside |
| tricin 7-O-β-D-glucopyranoside |