1,1-Dichloro-2,2,2-trifluoroethyl chlorodifluoromethyl ether structure
|
Common Name | 1,1-Dichloro-2,2,2-trifluoroethyl chlorodifluoromethyl ether | ||
|---|---|---|---|---|
| CAS Number | 32778-09-9 | Molecular Weight | 253.38300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3Cl3F5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1-Dichloro-2,2,2-trifluoroethyl chlorodifluoromethyl ether |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C3Cl3F5O |
|---|---|
| Molecular Weight | 253.38300 |
| Exact Mass | 251.89300 |
| PSA | 9.23000 |
| LogP | 3.48580 |
| InChIKey | QPYZGZHEKIQPIC-UHFFFAOYSA-N |
| SMILES | FC(F)(Cl)OC(Cl)(Cl)C(F)(F)F |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2909199090 |
|
~%
1,1-Dichloro-2,... CAS#:32778-09-9 |
| Literature: Journal of medicinal chemistry, , vol. 14, # 6 p. 517 - 519 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909199090 |
|---|---|
| Summary | 2909199090. other acyclic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1,1-dichloro-1-[chloro(difluoro)methoxy]-2,2,2-trifluoroethane |