1-decyl-N,N-diethylpiperidine-3-carboxamide,hydrobromide structure
|
Common Name | 1-decyl-N,N-diethylpiperidine-3-carboxamide,hydrobromide | ||
|---|---|---|---|---|
| CAS Number | 328-07-4 | Molecular Weight | 405.45600 | |
| Density | 0.913g/cm3 | Boiling Point | 431.4ºC at 760 mmHg | |
| Molecular Formula | C20H41BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-decyl-N,N-diethylpiperidine-3-carboxamide,hydrobromide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.913g/cm3 |
|---|---|
| Boiling Point | 431.4ºC at 760 mmHg |
| Molecular Formula | C20H41BrN2O |
| Molecular Weight | 405.45600 |
| Exact Mass | 404.24000 |
| PSA | 23.55000 |
| LogP | 5.60350 |
| Index of Refraction | 1.474 |
| InChIKey | CZKBSSSIQHATNU-UHFFFAOYSA-N |
| SMILES | Br.CCCCCCCCCCN1CCCC(C(=O)N(CC)CC)C1 |
| HS Code | 2933399090 |
|---|
|
~%
1-decyl-N,N-die... CAS#:328-07-4 |
| Literature: Zheng; Salgia; Thompson; Dillingham; Bond; Feng; Prasad; Gollamudi Journal of Medicinal Chemistry, 1995 , vol. 38, # 1 p. 180 - 188 |
|
~%
1-decyl-N,N-die... CAS#:328-07-4 |
| Literature: Zheng; Salgia; Thompson; Dillingham; Bond; Feng; Prasad; Gollamudi Journal of Medicinal Chemistry, 1995 , vol. 38, # 1 p. 180 - 188 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Piperidinecarboxamide,1-decyl-N,N-diethyl-,monohydrobromide |
| 1-Decyl-piperidin-3-carbonsaeure-diaethylamid,Hydrobromid |
| 1-decyl-piperidine-3-carboxylic acid diethylamide,hydrobromide |
| 1-decyl-N,N-diethylpiperidine-3-carboxamide hydrobromide |
| 1-Decyl-N,N-diethyl-3-piperidinecarboxamide hydrobromide |