2-Chloro-N-(2-chloro-5-(trifluoromethyl)phenyl)acetamide structure
|
Common Name | 2-Chloro-N-(2-chloro-5-(trifluoromethyl)phenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 328-26-7 | Molecular Weight | 272.05100 | |
| Density | 1.516g/cm3 | Boiling Point | 344.4ºC at 760 mmHg | |
| Molecular Formula | C9H6Cl2F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.1ºC | |
| Name | 2-chloro-N-[2-chloro-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.516g/cm3 |
|---|---|
| Boiling Point | 344.4ºC at 760 mmHg |
| Molecular Formula | C9H6Cl2F3NO |
| Molecular Weight | 272.05100 |
| Flash Point | 162.1ºC |
| Exact Mass | 270.97800 |
| PSA | 29.10000 |
| LogP | 3.60910 |
| Index of Refraction | 1.528 |
| InChIKey | YJUFYUGDUFBEDG-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1cc(C(F)(F)F)ccc1Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Chlor-essigsaeure-(2-chlor-5-trifluormethyl-anilid) |
| n1-[2-chloro-5-(trifluoromethyl)phenyl]-2-chloroacetamide |
| chloro-acetic acid-(2-chloro-5-trifluoromethyl-anilide) |
| 2-Chloro-N-(2-chloro-5-trifluoromethyl-phenyl)-acetamide |