4-(3-Bromo-phenylamino)-quinazoline-7-carboxylic acid
Modify Date: 2025-11-06 13:14:53
4-(3-Bromo-phenylamino)-quinazoline-7-carboxylic acid structure
|
Common Name | 4-(3-Bromo-phenylamino)-quinazoline-7-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 328528-75-2 | Molecular Weight | 344.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3-Bromo-phenylamino)-quinazoline-7-carboxylic acid |
|---|
| Molecular Formula | C15H10BrN3O2 |
|---|---|
| Molecular Weight | 344.16 |
| InChIKey | PMQYRRHKBIMTGT-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2c(Nc3cccc(Br)c3)ncnc2c1 |
|
Name: Concentration required to inhibit the human liver recombinant fructose-1,6-bisphospha...
Source: ChEMBL
Target: Fructose-1,6-bisphosphatase 1
External Id: CHEMBL694959
|
|
Name: Inhibition of human recombinant FBPase using fructose-1,6-biphosphate as substrate in...
Source: ChEMBL
Target: N/A
External Id: CHEMBL2091396
|
Total 2, Current Page 1 of 1
1