L-Cystine, 1,1'-dimethyl ester, hydrochloride structure
|
Common Name | L-Cystine, 1,1'-dimethyl ester, hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 32854-09-4 | Molecular Weight | 341.276 | |
| Density | N/A | Boiling Point | 375.5ºC at 760 mmHg | |
| Molecular Formula | C8H18Cl2N2O4S2 | Melting Point | 182-183 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 180.9ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of L-Cystine, 1,1'-dimethyl ester, hydrochlorideDimethyl 3,3'-disulfanediyl(2R,2'R)-bis(2-aminopropanoate) dihydrochloride is a cysteine derivative[1]. |
| Name | Dimethyl L-cystinate dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Dimethyl 3,3'-disulfanediyl(2R,2'R)-bis(2-aminopropanoate) dihydrochloride is a cysteine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Boiling Point | 375.5ºC at 760 mmHg |
|---|---|
| Melting Point | 182-183 °C (dec.)(lit.) |
| Molecular Formula | C8H18Cl2N2O4S2 |
| Molecular Weight | 341.276 |
| Flash Point | 180.9ºC |
| Exact Mass | 340.008514 |
| PSA | 155.24000 |
| LogP | 2.37300 |
| InChIKey | QKWGUPFPCRKKMQ-ANJCWRQCSA-N |
| SMILES | COC(=O)C(N)CSSCC(N)C(=O)OC.Cl.Cl |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22;R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~98%
L-Cystine, 1,1'... CAS#:32854-09-4 |
| Literature: Tetrahedron Letters, , vol. 55, # 6 p. 1132 - 1135 |
|
~%
L-Cystine, 1,1'... CAS#:32854-09-4
Detail
|
| Literature: Australian Journal of Chemistry, , vol. 64, # 4 p. 443 - 453 |
|
Detection of glucose using immobilized bienzyme on cyclic bisureas-gold nanoparticle conjugate.
Anal. Biochem. 459 , 31-8, (2014) A highly sensitive electrochemical glucose sensor has been developed by the co-immobilization of glucose oxidase (GOx) and horseradish peroxidase (HRP) onto a gold electrode modified with biocompatibl... |
| Dimethyl L-cystinate dihydrochloride |
| L-CYSTINE DIETHYL DIHYDROCHLORIDE |
| L-cystine-dimethylester dihydrochloride |
| bis(glycine)-L-cystine dimethyl ether hydrochloride |
| DIMETHYL CYSTINATE 2HCL |
| (H-L-Cys-OMe)2 |
| MFCD00012490 |
| EINECS 251-261-4 |
| L-Cystine-dimethyl Ester Dihydrochloride |
| (2R,2'R)-Dimethyl 3,3'-disulfanediylbis(2-aminopropanoate) dihydrochloride |
| Dimethyl L-Cystine dihydrochloride |
| L-Cystine, dimethyl ester, hydrochloride (1:2) |
| L-Cysteinedimethylester hydrochloride |
| L-cystine dimethyl ester hydrochloride |
| cystine-di-OMe dihydrochloride |
| (H-Cys-OMe)2 . 2 HCl,(Disulfide bond) |
| L-Cystine Dimethyl Ester 2HCl |
| L-cysteine dimethyl ester dihydrochloride |
| L-Cystine dimethyl ester dihydrochloride |
| (H-Cys-OMe)2.2HCl |
| L-Cystine, 1,1'-dimethyl ester, hydrochloride |