9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one
9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one structure
|
Common Name | 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one | ||
|---|---|---|---|---|
| CAS Number | 328546-65-2 | Molecular Weight | 207.18600 | |
| Density | 1.341g/cm3 | Boiling Point | 516.9ºC at 760mmHg | |
| Molecular Formula | C9H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.4ºC | |
Summary: 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one (CAS number: 328546-65-2), molecular formula C9H9N3O3, molecular weight 207.18600, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.341g/cm3 |
|---|---|
| Boiling Point | 516.9ºC at 760mmHg |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.18600 |
| Flash Point | 266.4ºC |
| Exact Mass | 207.06400 |
| PSA | 86.95000 |
| LogP | 1.74010 |
| Index of Refraction | 1.585 |
| InChIKey | ZSLHWCFNYIEQJJ-UHFFFAOYSA-N |
| SMILES | O=C1NCCNc2c1cccc2[N+](=O)[O-] |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 9-Nitro-1,2,3,4-tetrahydro-5H-1,4-benzodiazepin-5-one |
| 2,3,4,5-tetrahydro-9-nitro-1H-1,4-benzodiazepin-5-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one? |
| A: Polar surface area (PSA) of 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one is 86.95000. |
| Q: What is the LogP of 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one? |
| A: LogP of 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one is 1.74010. |
| Q: What is the boiling point of 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one? |
| A: Boiling point of 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one is 516.9ºC at 760mmHg. |
| Q: What is the SMILES notation of 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one? |
| A: SMILES notation of 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one is O=C1NCCNc2c1cccc2[N+](=O)[O-]. |
| Q: What is the CAS number of 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one? |
| A: CAS number of 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one is 328546-65-2. |
| Q: What is the English name of 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one? |
| A: The English name of 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one is 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one. |
| Q: What English synonyms does 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one have? |
| A: English synonyms of 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one: 9-Nitro-1,2,3,4-tetrahydro-5H-1,4-benzodiazepin-5-one, 2,3,4,5-tetrahydro-9-nitro-1H-1,4-benzodiazepin-5-one. |
| Q: What is the molecular weight of 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one? |
| A: Molecular weight of 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one is 207.18600. |
| Q: What is the InChIKey of 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one? |
| A: InChIKey of 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one is ZSLHWCFNYIEQJJ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one? |
| A: Molecular formula of 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one is C9H9N3O3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |