4-(Trifluoromethyl)benzoyl chloride structure
|
Common Name | 4-(Trifluoromethyl)benzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 329-15-7 | Molecular Weight | 208.565 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 186.4±0.0 °C at 760 mmHg | |
| Molecular Formula | C8H4ClF3O | Melting Point | -3°C | |
| MSDS | Chinese USA | Flash Point | 78.3±0.0 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | α,α,α-Trifluoro-o-toluoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 186.4±0.0 °C at 760 mmHg |
| Melting Point | -3°C |
| Molecular Formula | C8H4ClF3O |
| Molecular Weight | 208.565 |
| Flash Point | 78.3±0.0 °C |
| Exact Mass | 207.990280 |
| PSA | 17.07000 |
| LogP | 3.18 |
| Vapour Pressure | 0.7±0.3 mmHg at 25°C |
| Index of Refraction | 1.467 |
| InChIKey | OXZYBOLWRXENKT-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccc(C(F)(F)F)cc1 |
| Water Solubility | decomposes |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R29;R34 |
| Safety Phrases | S26-S36/37/39-S45-S8 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 29163900 |
|
~99%
4-(Trifluoromet... CAS#:329-15-7 |
| Literature: Chen, Yin-Bo; Li, Ji-Ling; Shao, Xu-Sheng; Xu, Xiao-Yong; Li, Zhong Chinese Chemical Letters, 2013 , vol. 24, # 8 p. 673 - 676 |
|
~85%
4-(Trifluoromet... CAS#:329-15-7 |
| Literature: Quesnel, Jeffrey S.; Arndtsen, Bruce A. Journal of the American Chemical Society, 2013 , vol. 135, # 45 p. 16841 - 16844 |
|
~%
4-(Trifluoromet... CAS#:329-15-7 |
| Literature: US4808762 A1, ; |
|
~%
4-(Trifluoromet... CAS#:329-15-7 |
| Literature: Molecular Crystals and Liquid Crystals (1969-1991), , vol. 66, p. 123 - 132 |
|
~%
4-(Trifluoromet... CAS#:329-15-7 |
| Literature: Journal of the American Chemical Society, , vol. 136, # 9 p. 3354 - 3357 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Microwave-promoted cross-coupling of acid chlorides with arylboronic acids: a convenient method for preparing aromatic ketones. Polácková V, et al.
Tetrahedron 62(50) , 11675-78, (2006)
|
| Benzoyl chloride, 4-(trifluoromethyl)- |
| p-Toluoyl chloride, α,α,α-trifluoro- |
| 4-(Trifluoromethyl)benzoyl chloride |
| 4-trifluoromethylbenzoylchloride |
| EINECS 206-342-9 |
| 4-(trifluoromethyl)-1-benzenecarbonyl chloride |
| 4-(TRIFLUOROMETHYL)BENZOYL CHL |
| 4-(TRIFLUORMETHYL)-BENZOYL CHLORIDE |
| p-Toluoyl chloride, α, α,α-trifluoro- |
| 4-(trifluoromethyl)-benzoylchlorid |
| p-(trifluoromethyl)benzoyl chloride |
| 4-(Trifluoromethyl)Benzoyl cholride |
| PTF-BOC |
| GVR DXFFF |
| α,α,α-Trifluoro-p-toluoyl chloride |
| p-Trifluoromethylbenzoic acid chloride |
| MFCD00000694 |