Trimethylolpropane trimethacrylate structure
|
Common Name | Trimethylolpropane trimethacrylate | ||
|---|---|---|---|---|
| CAS Number | 3290-92-4 | Molecular Weight | 338.395 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 422.1±25.0 °C at 760 mmHg | |
| Molecular Formula | C18H26O6 | Melting Point | -25°C | |
| MSDS | Chinese USA | Flash Point | 181.4±23.2 °C | |
| Symbol |
GHS09 |
Signal Word | ||
| Name | Trimethylolpropane trimethacrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 422.1±25.0 °C at 760 mmHg |
| Melting Point | -25°C |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.395 |
| Flash Point | 181.4±23.2 °C |
| Exact Mass | 338.172943 |
| PSA | 78.90000 |
| LogP | 3.15 |
| Vapour density | >1 (vs air) |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.470 |
| InChIKey | OKKRPWIIYQTPQF-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC(CC)(COC(=O)C(=C)C)COC(=O)C(=C)C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
|
~%
Trimethylolprop... CAS#:3290-92-4 |
| Literature: US2010/204509 A1, ; Page/Page column 5 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
|
Cholesterol-based polymeric monolithic columns for capillary liquid chromatography.
J. Chromatogr. A. 1373 , 114-23, (2014) A novel, cholesterol-based polymeric monolithic stationary phase for capillary liquid chromatography, was prepared by thermally initiated in-situ polymerization. Cholesteryl methacrylate (CholMA) was ... |
|
|
Synthesis and evaluation of uniformly sized nalidixic acid-imprinted nanospheres based on precipitation polymerization method for analytical and biomedical applications.
J. Mol. Recognit. 25(7) , 404-13, (2012) For the first time in this work, uniform molecularly imprinted polymer (MIP) nanoparticles were prepared using nalidixic acid as a template. The MIP nanoparticles were successfully synthesized by prec... |
|
|
Molecularly imprinted polymer nanocarriers for sustained release of erythromycin.
Pharm. Res. 32(2) , 375-88, (2015) To develop and evaluate molecularly imprinted nanocarriers for sustained release of erythromycin in physiological buffer media.Erythromycin-imprinted poly(methacrylic acid-co-trimethylolpropane trimet... |
| EINECS 221-950-4 |
| sr350 |
| 2,2-bis{[(2-methylacryloyl)oxy]methyl}butyl 2-methylprop-2-enoate |
| 2,2-Bis(methacryloyloxymethyl)butyl methacrylate |
| 2-propenoic acid, 2-methyl-, 2,2-bis[[(2-methyl-1-oxo-2-propen-1-yl)oxy]methyl]butyl ester |
| nkestertmpt |
| 2,2-bis{[(2-methylacryloyl)oxy]methyl}butyl 2-methylprop-2-enoate (non-preferred name) |
| saret515 |
| blemmerptt |
| 1,1,1-Trimethylolpropane trimethacrylate |
| trimethylopropane trimethacrylate |
| td1500s |
| 2,2-bis(hydroxymethyl)butanol trimethacrylate |
| 2-Propenoic acid, 2-methyl-, 2-ethyl-2-[[(2-methyl-1-oxo-2-propenyl)oxy]methyl]-1,3-propanediyl ester |
| td1500 |
| MFCD00008588 |
| 2,2-Bis[(methacryloyloxy)methyl]butyl methacrylate |
| trimethylpropane trimethacrylate |
| TMPTMA |
| Trimethylolpropane trimethacrylate |
| Methacrylic acid, triester with 2-ethyl-2-(hydroxymethyl)-1,3-propanediol |
| hi-crossm |
| trimethylol propane trimethacrylate |
| atm11 |
| chemlink30 |
| 2-Ethyl-2-((methacryloyloxy)methyl)propane-1,3-diyl bis(2-methylacrylate) |
| 2-Ethyl-2-hydroxymethyl-1,3-propanediol Trimethacrylate |