2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one
2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one structure
|
Common Name | 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one | ||
|---|---|---|---|---|
| CAS Number | 32905-66-1 | Molecular Weight | 227.34300 | |
| Density | 0.965g/cm3 | Boiling Point | 333.5ºC at 760 mmHg | |
| Molecular Formula | C13H25NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.965g/cm3 |
|---|---|
| Boiling Point | 333.5ºC at 760 mmHg |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.34300 |
| Flash Point | 155.5ºC |
| Exact Mass | 227.18900 |
| PSA | 29.54000 |
| LogP | 2.24550 |
| Index of Refraction | 1.465 |
| InChIKey | ZBZVJMYFNIEABO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)C(=O)N1CCOCC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,2,4,4-tetrame... CAS#:32905-66-1 |
| Literature: Lespagnol,A. et al. Chimica Therapeutica, 1971 , vol. 6, p. 208 - 214 |
|
~%
2,2,4,4-tetrame... CAS#:32905-66-1 |
| Literature: Lespagnol,A. et al. Chimica Therapeutica, 1971 , vol. 6, p. 208 - 214 |
|
~%
2,2,4,4-tetrame... CAS#:32905-66-1 |
| Literature: Lespagnol,A. et al. Chimica Therapeutica, 1971 , vol. 6, p. 208 - 214 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one? |
| A: The English name of 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one is 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one. |
| Q: What is the Chinese name of 32905-66-1? |
| A: Chinese name of 32905-66-1 is 32905-66-1. |
| Q: What is the boiling point of 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one? |
| A: Boiling point of 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one is 333.5ºC at 760 mmHg. |
| Q: What is the LogP of 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one? |
| A: LogP of 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one is 2.24550. |
| Q: What are the upstream materials of 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one? |
| A: Related upstream materials(CAS) of 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one: 6111-88-2;3302-12-3;110-91-8;32905-63-8. |
| Q: What is the CAS number of 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one? |
| A: CAS number of 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one is 32905-66-1. |
| Q: What is the SMILES notation of 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one? |
| A: SMILES notation of 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one is CC(C)(C)CC(C)(C)C(=O)N1CCOCC1. |
| Q: What is the InChIKey of 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one? |
| A: InChIKey of 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one is ZBZVJMYFNIEABO-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one? |
| A: Molecular formula of 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one is C13H25NO2. |
| Q: What is the molecular weight of 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one? |
| A: Molecular weight of 2,2,4,4-tetramethyl-1-morpholin-4-ylpentan-1-one is 227.34300. |