2-cyano-N-(4-sulfamoylphenyl)acetamide structure
|
Common Name | 2-cyano-N-(4-sulfamoylphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 32933-40-7 | Molecular Weight | 239.25100 | |
| Density | 1.482g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H9N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-cyano-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.482g/cm3 |
|---|---|
| Molecular Formula | C9H9N3O3S |
| Molecular Weight | 239.25100 |
| Exact Mass | 239.03600 |
| PSA | 121.43000 |
| LogP | 2.04028 |
| Index of Refraction | 1.621 |
| InChIKey | IQSWUJWQROLSRO-UHFFFAOYSA-N |
| SMILES | N#CCC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| HS Code | 2935009090 |
|---|
|
~90%
2-cyano-N-(4-su... CAS#:32933-40-7 |
| Literature: Ammar, Yousry A.; Aly, Mohsen M.; Al-Sehemi, Abd Allah G.; Salem, Mohamed A.; El-Gaby, Mohamed S.A. Journal of the Chinese Chemical Society, 2009 , vol. 56, # 5 p. 1064 - 1071 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 4-(sulfamoyl)cyanoacetanilide |
| 2-Cyano-N-(4-sulfamoyl-phenyl)-acetamide |
| cyanoaceto-4-sulfamoylanilide |