a-D-Glucofuranose, 1,2-O-(1-methylethylidene)-6-thio-, cyclic5,6-carbonate 3-(4-methylbenzenesulfonate) (9CI) structure
|
Common Name | a-D-Glucofuranose, 1,2-O-(1-methylethylidene)-6-thio-, cyclic5,6-carbonate 3-(4-methylbenzenesulfonate) (9CI) | ||
|---|---|---|---|---|
| CAS Number | 32953-63-2 | Molecular Weight | 416.46600 | |
| Density | 1.49g/cm3 | Boiling Point | 552.2ºC at 760mmHg | |
| Molecular Formula | C17H20O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.7ºC | |
| Name | [2,2-dimethyl-5-(2-oxo-1,3-oxathiolan-5-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 552.2ºC at 760mmHg |
| Molecular Formula | C17H20O8S2 |
| Molecular Weight | 416.46600 |
| Flash Point | 287.7ºC |
| Exact Mass | 416.06000 |
| PSA | 131.04000 |
| LogP | 3.27810 |
| Index of Refraction | 1.616 |
| InChIKey | DZZIFCAXVAWYCV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OC2C(C3CSC(=O)O3)OC3OC(C)(C)OC32)cc1 |
|
~%
a-D-Glucofurano... CAS#:32953-63-2 |
| Literature: Tsuda, Yoshisuke; Sato, Yoshiyuki; Kanemitsu, Kimihiro; Hosoi, Shinzo; Shibayama, Kenji; Nakao, Kayo; Ishikawa, Yuko Chemical and Pharmaceutical Bulletin, 1996 , vol. 44, # 8 p. 1465 - 1475 |
|
~%
a-D-Glucofurano... CAS#:32953-63-2 |
| Literature: Tsuda, Yoshisuke; Sato, Yoshiyuki; Kanemitsu, Kimihiro; Hosoi, Shinzo; Shibayama, Kenji; Nakao, Kayo; Ishikawa, Yuko Chemical and Pharmaceutical Bulletin, 1996 , vol. 44, # 8 p. 1465 - 1475 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,2-dimethyl-5-(2-oxo-1,3-oxathiolan-5-yl)tetrahydrofuro[2,3-d][1,3]dioxol-6-yl 4-methylbenzenesulfonate (non-preferred name) |
| [(3aR,5R,6S,6aR)-2,2-dimethyl-5-[(5S)-2-oxo-1,3-oxathiolan-5-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] 4-methylbenzenesulfonate |