8-phenyl-3,7-dihydropurine-6-thione structure
|
Common Name | 8-phenyl-3,7-dihydropurine-6-thione | ||
|---|---|---|---|---|
| CAS Number | 3298-76-8 | Molecular Weight | 228.27300 | |
| Density | 1.5g/cm3 | Boiling Point | 529.2ºC at 760 mmHg | |
| Molecular Formula | C11H8N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.8ºC | |
| Name | 8-phenyl-3,7-dihydropurine-6-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 529.2ºC at 760 mmHg |
| Molecular Formula | C11H8N4S |
| Molecular Weight | 228.27300 |
| Flash Point | 273.8ºC |
| Exact Mass | 228.04700 |
| PSA | 89.45000 |
| LogP | 2.68250 |
| Index of Refraction | 1.804 |
| InChIKey | HDZBMCOWYLRKDG-UHFFFAOYSA-N |
| SMILES | S=c1nc[nH]c2nc(-c3ccccc3)[nH]c12 |
| HS Code | 2933990090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-phenyl-6-mercaptopurine |
| 6-Mercapto-8-phenyl-purin |
| 8-phenyl-1,7-dihydro-purine-6-thione |