2-(hydroxyamino)-3,7-dihydropurine-6-thione structure
|
Common Name | 2-(hydroxyamino)-3,7-dihydropurine-6-thione | ||
|---|---|---|---|---|
| CAS Number | 33799-08-5 | Molecular Weight | 183.19100 | |
| Density | 2.14g/cm3 | Boiling Point | 593.1ºC at 760 mmHg | |
| Molecular Formula | C5H5N5OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312.5ºC | |
| Name | 2-(hydroxyamino)-3,7-dihydropurine-6-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 2.14g/cm3 |
|---|---|
| Boiling Point | 593.1ºC at 760 mmHg |
| Molecular Formula | C5H5N5OS |
| Molecular Weight | 183.19100 |
| Flash Point | 312.5ºC |
| Exact Mass | 183.02100 |
| PSA | 125.52000 |
| LogP | 0.51570 |
| Index of Refraction | 2.042 |
| InChIKey | KKRAGNQZMCYCHW-UHFFFAOYSA-N |
| SMILES | ONc1nc(=S)c2[nH]cnc2[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3,6,7-Tetrahydro-6-thioxo-2H-purin-2-one oxime |
| 2H-Purin-2-one,1,3,6,7-tetrahydro-6-thioxo-,oxime |