WAY-603392 structure
|
Common Name | WAY-603392 | ||
|---|---|---|---|---|
| CAS Number | 329906-01-6 | Molecular Weight | 256.32134 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 387.4±52.0 °C at 760 mmHg | |
| Molecular Formula | C11H16N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.1±30.7 °C | |
Use of WAY-603392AKT(PKB) phosphorylation inhibitors; ion channel modulators; ion channel modulators; ion channel modulators; |
| Name | WAY-603392 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 387.4±52.0 °C at 760 mmHg |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.32134 |
| Flash Point | 188.1±30.7 °C |
| Exact Mass | 256.088165 |
| LogP | 0.04 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | NDZOLYPESIETMS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1csc(N2CCOCC2)n1 |
| 4-Thiazoleacetic acid, 2-(4-morpholinyl)-, ethyl ester |
| MFCD02710102 |
| Ethyl [2-(4-morpholinyl)-1,3-thiazol-4-yl]acetate |