4-(trifluoromethoxy)benzoyl fluoride
Modify Date: 2025-09-12 19:00:53
4-(trifluoromethoxy)benzoyl fluoride structure
|
Common Name | 4-(trifluoromethoxy)benzoyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 330-11-0 | Molecular Weight | 208.11000 | |
| Density | 1.384g/cm3 | Boiling Point | 179.7ºC at 760mmHg | |
| Molecular Formula | C8H4F4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 61.2ºC | |
| Name | 4-(trifluoromethoxy)benzoyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.384g/cm3 |
|---|---|
| Boiling Point | 179.7ºC at 760mmHg |
| Molecular Formula | C8H4F4O2 |
| Molecular Weight | 208.11000 |
| Flash Point | 61.2ºC |
| Exact Mass | 208.01500 |
| PSA | 26.30000 |
| LogP | 2.69490 |
| Index of Refraction | 1.431 |
| InChIKey | UKJWAZZCGZQPTA-UHFFFAOYSA-N |
| SMILES | O=C(F)c1ccc(OC(F)(F)F)cc1 |
| Risk Phrases | 34 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 3265 |
|
~%
4-(trifluoromet... CAS#:330-11-0 |
| Literature: Eli Lilly and Company Patent: US4318866 A1, 1982 ; |
|
~%
4-(trifluoromet... CAS#:330-11-0 |
| Literature: Jagupol'skii; Troizkaja Zhurnal Obshchei Khimii, 1957 , vol. 27, p. 518,522; engl. Ausg. S. 587, 591 |
| p-Trifluoromethoxybenzoyl fluoride |
| EINECS 206-351-8 |
| 4-trifluoromethoxy-benzoyl fluoride |
| 4-Trifluormethoxy-benzoylfluorid |
| 2,2,3,3-TETRAFLUORO-1,4-BUTANEDIOL |
| Benzoyl fluoride,4-(trifluoromethoxy) |