8-Methyl Chrysophanol structure
|
Common Name | 8-Methyl Chrysophanol | ||
|---|---|---|---|---|
| CAS Number | 3300-25-2 | Molecular Weight | 268.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 8-Methyl Chrysophanol8-Methyl Chrysophanol is an anthraquinone isolated from the bark of Senna macranth[1]. |
| Name | 1-hydroxy-8-methoxy-3-methylanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Description | 8-Methyl Chrysophanol is an anthraquinone isolated from the bark of Senna macranth[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H12O4 |
|---|---|
| Molecular Weight | 268.26400 |
| Exact Mass | 268.07400 |
| PSA | 63.60000 |
| LogP | 2.48460 |
| InChIKey | HOGWLZYYLVDAOW-UHFFFAOYSA-N |
| SMILES | COc1cccc2c1C(=O)c1c(O)cc(C)cc1C2=O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914690090 |
| HS Code | 2914690090 |
|---|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 9,10-Anthracenedione,1-hydroxy-8-methoxy-3-methyl |
| 1-hydroxy-8-methoxy-3-methyl-9,10-antraquinone |
| 1-hydroxy-8-methoxy-3-methylanthra-9,10-quinone |
| 1-Hydroxy-8-methoxy-3-methyl-9,10-anthrachinon |
| 1-hydroxy-8-methoxy-3-methylanthraquinone |
| 1-hydroxy-8-methoxy-3-methyl-9,10-anthraquinone |
| chrysophanol 8-O-methyl ether |
| 9-Methoxychrysophanol |