Benzenesulfonamide,N-[[(2-chloroethyl)amino]carbonyl]-4-methyl- structure
|
Common Name | Benzenesulfonamide,N-[[(2-chloroethyl)amino]carbonyl]-4-methyl- | ||
|---|---|---|---|---|
| CAS Number | 33021-74-8 | Molecular Weight | 276.74000 | |
| Density | 1.339g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H13ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-chloroethyl)-3-(4-methylphenyl)sulfonylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.339g/cm3 |
|---|---|
| Molecular Formula | C10H13ClN2O3S |
| Molecular Weight | 276.74000 |
| Exact Mass | 276.03400 |
| PSA | 83.65000 |
| LogP | 3.08430 |
| Index of Refraction | 1.555 |
| InChIKey | UNTSROPEGZLPAH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)NCCCl)cc1 |
|
~%
Benzenesulfonam... CAS#:33021-74-8 |
| Literature: Johnston; McCaleb; Opliger; Laster; Montgomery Journal of medicinal chemistry, 1971 , vol. 14, # 17 p. 600 - 614 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| N-Toluol-4-sulfonyl-N-<2-chlorethyl>-harnstoff |
| N-<4-Methyl-benzolsulfonyl>-N'-<2-chlor-ethyl>-harnstoff |