1-(2-fluoroethyl)-3-(4-methylphenyl)sulfonyl-1-nitroso-urea structure
|
Common Name | 1-(2-fluoroethyl)-3-(4-methylphenyl)sulfonyl-1-nitroso-urea | ||
|---|---|---|---|---|
| CAS Number | 33024-49-6 | Molecular Weight | 289.28300 | |
| Density | 1.43g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H12FN3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-fluoroethyl)-3-(4-methylphenyl)sulfonyl-1-nitrosourea |
|---|
| Density | 1.43g/cm3 |
|---|---|
| Molecular Formula | C10H12FN3O4S |
| Molecular Weight | 289.28300 |
| Exact Mass | 289.05300 |
| PSA | 104.29000 |
| LogP | 2.81790 |
| Index of Refraction | 1.579 |
| InChIKey | QGJCXTUSTDQKLP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)N(CCF)N=O)cc1 |
|
~%
1-(2-fluoroethy... CAS#:33024-49-6 |
| Literature: Johnston; McCaleb; Opliger; Laster; Montgomery Journal of medicinal chemistry, 1971 , vol. 14, # 17 p. 600 - 614 |
|
~%
1-(2-fluoroethy... CAS#:33024-49-6 |
| Literature: Johnston; McCaleb; Opliger; Laster; Montgomery Journal of medicinal chemistry, 1971 , vol. 14, # 17 p. 600 - 614 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |