1-[2-chloro-3-(cyclohexylcarbamoylamino)propyl]-3-cyclohexyl-urea structure
|
Common Name | 1-[2-chloro-3-(cyclohexylcarbamoylamino)propyl]-3-cyclohexyl-urea | ||
|---|---|---|---|---|
| CAS Number | 33024-50-9 | Molecular Weight | 358.90700 | |
| Density | 1.16g/cm3 | Boiling Point | 624.8ºC at 760 mmHg | |
| Molecular Formula | C17H31ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 331.6ºC | |
| Name | 1-[2-chloro-3-(cyclohexylcarbamoylamino)propyl]-3-cyclohexylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 624.8ºC at 760 mmHg |
| Molecular Formula | C17H31ClN4O2 |
| Molecular Weight | 358.90700 |
| Flash Point | 331.6ºC |
| Exact Mass | 358.21400 |
| PSA | 82.26000 |
| LogP | 4.42120 |
| Index of Refraction | 1.536 |
| InChIKey | RXNSTIHLXUEOJL-UHFFFAOYSA-N |
| SMILES | O=C(NCC(Cl)CNC(=O)NC1CCCCC1)NC1CCCCC1 |
|
~%
1-[2-chloro-3-(... CAS#:33024-50-9 |
| Literature: Johnston; McCaleb; Opliger; Laster; Montgomery Journal of medicinal chemistry, 1971 , vol. 14, # 17 p. 600 - 614 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1,1'-<2-Chlor-propandiyl>-bis-<3-cyclohexyl>-harnstoff,2-Chlor-1,3-bis-<N'-cyclohexyl-ureido>-propan |