1-[2-chloro-3-(cyclohexylcarbamoyl-nitroso-amino)propyl]-3-cyclohexyl-1-nitroso-urea structure
|
Common Name | 1-[2-chloro-3-(cyclohexylcarbamoyl-nitroso-amino)propyl]-3-cyclohexyl-1-nitroso-urea | ||
|---|---|---|---|---|
| CAS Number | 33024-51-0 | Molecular Weight | 416.90300 | |
| Density | 1.44g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H29ClN6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Chlor-1,3,5-trimethyl-4-nitro-benzol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Molecular Formula | C17H29ClN6O4 |
| Molecular Weight | 416.90300 |
| Exact Mass | 416.19400 |
| PSA | 123.54000 |
| LogP | 4.42700 |
| Index of Refraction | 1.641 |
| InChIKey | LOCWSNJMMKPGFO-UHFFFAOYSA-N |
| SMILES | O=NN(CC(Cl)CN(N=O)C(=O)NC1CCCCC1)C(=O)NC1CCCCC1 |
|
~%
1-[2-chloro-3-(... CAS#:33024-51-0 |
| Literature: Johnston; McCaleb; Opliger; Laster; Montgomery Journal of medicinal chemistry, 1971 , vol. 14, # 17 p. 600 - 614 |
|
~%
1-[2-chloro-3-(... CAS#:33024-51-0 |
| Literature: Johnston; McCaleb; Opliger; Laster; Montgomery Journal of medicinal chemistry, 1971 , vol. 14, # 17 p. 600 - 614 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Chloro-4-nitromesitylen |
| 2-chloro-1,3,5-trimethyl-4-nitro-benzene |
| 2-Chlor-1,3-bis-(N'-cyclohexyl-N-nitroso-ureido)-propan |
| 2-Chlor-4-nitro-mesitylen |