1H-Pyrazole,3-(4-methylphenyl)-1,5-diphenyl structure
|
Common Name | 1H-Pyrazole,3-(4-methylphenyl)-1,5-diphenyl | ||
|---|---|---|---|---|
| CAS Number | 16112-34-8 | Molecular Weight | 310.39200 | |
| Density | 1.08g/cm3 | Boiling Point | 487.3ºC at 760mmHg | |
| Molecular Formula | C22H18N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.5ºC | |
| Name | 3-(4-methylphenyl)-1,5-diphenylpyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 487.3ºC at 760mmHg |
| Molecular Formula | C22H18N2 |
| Molecular Weight | 310.39200 |
| Flash Point | 248.5ºC |
| Exact Mass | 310.14700 |
| PSA | 17.82000 |
| LogP | 5.51470 |
| Vapour Pressure | 3.57E-09mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | HWNIPAADGXCGJV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)n(-c3ccccc3)n2)cc1 |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
| 1,5-diphenyl-3-p-tolyl-1H-pyrazole |
| 1,5-Diphenyl-3-p-tolyl-pyrazol |
| 3-<p-Tolyl>-1,5-diphenyl-pyrazol |
| 1,5-Diphenyl-3-p-tolyl-1H-pyrazol |