Endrin alcohol structure
|
Common Name | Endrin alcohol | ||
|---|---|---|---|---|
| CAS Number | 33058-12-7 | Molecular Weight | 380.90900 | |
| Density | 2.04g/cm3 | Boiling Point | 447.7ºC at 760 mmHg | |
| Molecular Formula | C12H8Cl6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.6ºC | |
| Name | 1,8,9,10,11,11-Hexachlorohexacyclo<6.2.1.13,6.02,7.04,10.05,9>dodecan-5-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 2.04g/cm3 |
|---|---|
| Boiling Point | 447.7ºC at 760 mmHg |
| Molecular Formula | C12H8Cl6O |
| Molecular Weight | 380.90900 |
| Flash Point | 224.6ºC |
| Exact Mass | 377.87100 |
| PSA | 20.23000 |
| LogP | 3.35450 |
| Index of Refraction | 1.75 |
| InChIKey | FWIOOTDZGJSQMX-UHFFFAOYSA-N |
| SMILES | OC12C3CC4C5C3C3(Cl)C(Cl)(Cl)C5(Cl)C(Cl)(C41)C23Cl |
|
~90%
Endrin alcohol CAS#:33058-12-7 |
| Literature: Dong, Dao Cong; Edward, John T. Journal of Organic Chemistry, 1980 , vol. 45, # 12 p. 2395 - 2399 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| endrin alcohol |
| 1,8,9,10,11,11-Hexachlor-5-hydroxy-hexacylo<6.2.1.13.6.02.7.04.10.05.9>dodecan |
| Endrinalkohol |