Endrin-ketone structure
|
Common Name | Endrin-ketone | ||
|---|---|---|---|---|
| CAS Number | 53494-70-5 | Molecular Weight | 346.46400 | |
| Density | 1.86g/cm3 | Boiling Point | 457.7ºC at 760 mmHg | |
| Molecular Formula | C12H9Cl5O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 192.6ºC | |
| Symbol |
GHS02, GHS05 |
Signal Word | Danger | |
| Name | endrin ketone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.86g/cm3 |
|---|---|
| Boiling Point | 457.7ºC at 760 mmHg |
| Molecular Formula | C12H9Cl5O |
| Molecular Weight | 346.46400 |
| Flash Point | 192.6ºC |
| Exact Mass | 343.91000 |
| PSA | 17.07000 |
| LogP | 3.44730 |
| Index of Refraction | 1.671 |
| InChIKey | IZHZFAQWVKBTSL-VFUTZTILSA-N |
| SMILES | O=C1C2CC3C1C1(Cl)C(Cl)C4(Cl)C2C3C1(Cl)C4(Cl)Cl |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS02, GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H318 |
| Precautionary Statements | P210-P280-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | F,Xn,T+ |
| Risk Phrases | 11-20/21/22-36-28 |
| Safety Phrases | 16-26-36-45-36/37-28 |
| RIDADR | UN 2761 |
| RTECS | PC8600000 |
| Packaging Group | I |
| Hazard Class | 6.1(a) |
|
Determination of organochlorine pesticides and their metabolites in soil samples using headspace solid-phase microextraction.
J. Chromatogr. A. 918(1) , 177-88, (2001) An analytical procedure was developed using headspace solid-phase microextraction (HS-SPME) for the determination of organochlorine pesticides (OCPs) and their metabolites in sandy soil samples. The d... |
|
|
Solvent microextraction of chlorinated pesticides. De Jager LS and Andrews ARJ.
Chromatographia 50(11-12) , 733-38, (1999)
|
|
|
Chromous chloride reductions. V. Reaction of endrin ketone (II) with chromous chloride solution. Chau ASY, et al.
Bull. Environ. Contam. Toxicol. 6(6) , 481-84, (1971)
|
| 1,2,3,9,10,10-Hexachlor-1,3-bis-homo-cuban |
| Photoendrin |
| Photochlorden |
| Endrin Ketone |
| MFCD00152482 |
| EINECS 200-835-2 |
| Delta-Ketoendrin |