2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazino]-1-ethanol structure
|
Common Name | 2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazino]-1-ethanol | ||
|---|---|---|---|---|
| CAS Number | 330633-81-3 | Molecular Weight | 319.28000 | |
| Density | 1.369g/cm3 | Boiling Point | 428.1ºC at 760 mmHg | |
| Molecular Formula | C13H16F3N3O3 | Melting Point | 108-110ºC | |
| MSDS | N/A | Flash Point | 212.7ºC | |
| Name | 2-[4-[2-nitro-4-(trifluoromethyl)phenyl]piperazin-1-yl]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.369g/cm3 |
|---|---|
| Boiling Point | 428.1ºC at 760 mmHg |
| Melting Point | 108-110ºC |
| Molecular Formula | C13H16F3N3O3 |
| Molecular Weight | 319.28000 |
| Flash Point | 212.7ºC |
| Exact Mass | 319.11400 |
| PSA | 72.53000 |
| LogP | 2.25400 |
| Index of Refraction | 1.533 |
| InChIKey | CSQYNPKWTDSSNB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1N1CCN(CCO)CC1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD01173874 |