1,9-Dimethylxanthine structure
|
Common Name | 1,9-Dimethylxanthine | ||
|---|---|---|---|---|
| CAS Number | 33073-01-7 | Molecular Weight | 180.164 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H8N4O2 | Melting Point | ≥300ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,9-dimethyl-3H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Melting Point | ≥300ºC |
| Molecular Formula | C7H8N4O2 |
| Molecular Weight | 180.164 |
| Exact Mass | 180.064728 |
| PSA | 72.68000 |
| LogP | -1.57 |
| Index of Refraction | 1.737 |
| InChIKey | XKZALMBJTMJPFU-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)[nH]c2c(ncn2C)c1=O |
| Safety Phrases | 22-24/25 |
|---|---|
| WGK Germany | 3 |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,9-dihydro-1,9-dimethyl-1H-purine-2,6-dione |
| 1,9-Dimethyl-isoxanthin |
| 1,9-dimethyl-3,9-dihydro-purine-2,6-dione |
| 2,6-Dihydroxy-1,9-dimethylpurine |
| 1,9-Dimethyl-3,9-dihydro-purin-2,6-dion |
| 1,9-Dimethyl-3,9-dihydro-1H-purine-2,6-dione |
| 1H-Purine-2,6-dione, 3,9-dihydro-1,9-dimethyl- |
| 1,9-DimethylX |
| EINECS 251-367-0 |
| 1,9-Dimethylxanthine |