2-(3-Chloropropyl)-2-(4-fluorophenyl)-1,3-dioxolane structure
|
Common Name | 2-(3-Chloropropyl)-2-(4-fluorophenyl)-1,3-dioxolane | ||
|---|---|---|---|---|
| CAS Number | 3308-94-9 | Molecular Weight | 244.69000 | |
| Density | 1.219 | Boiling Point | 162-166 °C (15 mmHg) | |
| Molecular Formula | C12H14ClFO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.4ºC | |
| Name | 2-(3-Chloropropyl)-2-(4-fluorophenyl)-1,3-dioxolane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.219 |
|---|---|
| Boiling Point | 162-166 °C (15 mmHg) |
| Molecular Formula | C12H14ClFO2 |
| Molecular Weight | 244.69000 |
| Flash Point | 147.4ºC |
| Exact Mass | 244.06700 |
| PSA | 18.46000 |
| LogP | 3.04430 |
| Index of Refraction | 1.505-1.5075 |
| InChIKey | FXFDJSQOCVDXBX-UHFFFAOYSA-N |
| SMILES | Fc1ccc(C2(CCCCl)OCCO2)cc1 |
| Water Solubility | insoluble |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39-S26 |
| HS Code | 2932999099 |
|
~99%
2-(3-Chloroprop... CAS#:3308-94-9 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 21, # 12 p. 3622 - 3626 |
|
~93%
2-(3-Chloroprop... CAS#:3308-94-9 |
| Literature: US4994460 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 9 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 221-993-9 |
| MFCD00020909 |