sodium phthalimide structure
|
Common Name | sodium phthalimide | ||
|---|---|---|---|---|
| CAS Number | 33081-78-6 | Molecular Weight | 169.11300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4NNaO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium phthalimide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H4NNaO2 |
|---|---|
| Molecular Weight | 169.11300 |
| Exact Mass | 169.01400 |
| PSA | 37.38000 |
| LogP | 0.68480 |
| InChIKey | WUPVYJJCKYSGCR-UHFFFAOYSA-M |
| SMILES | O=C1N=C([O-])c2ccccc21.[Na+] |
| HS Code | 2925190090 |
|---|
|
~%
sodium phthalimide CAS#:33081-78-6 |
| Literature: Jarvis, Scott B. D.; Charette, Andre B. Organic Letters, 2011 , vol. 13, # 15 p. 3830 - 3833 |
|
~%
sodium phthalimide CAS#:33081-78-6 |
| Literature: Blacher Chemische Berichte, 1895 , vol. 28, p. 2358 |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| phthalimide,sodium-compound |
| sodiophthalimide |
| Phthalimid,Natrium-Verbindung |
| PHTHALIMIDE SODIUM SALT |
| sodium salt of phthalimide |
| sodium phthalimidate |