sodium dodecyl sulfate structure
|
Common Name | sodium dodecyl sulfate | ||
|---|---|---|---|---|
| CAS Number | 751-21-3 | Molecular Weight | 492.48500 | |
| Density | 1.03 g/mL at 20ºC | Boiling Point | N/A | |
| Molecular Formula | C21H25N4O6PS | Melting Point | 206-207ºC(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-(2-(N-((4-amino-2-methylpyrimidin-5-yl)methyl)formamido)-5-(phosphonooxy)pent-2-en-3-yl) 3-phenylprop-2-enethioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.03 g/mL at 20ºC |
|---|---|
| Melting Point | 206-207ºC(lit.) |
| Molecular Formula | C21H25N4O6PS |
| Molecular Weight | 492.48500 |
| Exact Mass | 492.12300 |
| PSA | 191.05000 |
| LogP | 4.24680 |
| InChIKey | LHNAQHBDWJZZKV-AUKAFYEZSA-N |
| SMILES | CC(=C(CCOP(=O)(O)O)SC(=O)C=Cc1ccccc1)N(C=O)Cc1cnc(C)nc1N |
| Water Solubility | H2O: 0.1 M, clear to nearly clear, colorless to slightly yellow |
| HS Code | 3402110000 |
|---|
| 3-phenyl-thioacrylic acid S-{2-[(4-amino-2-methyl-pyrimidin-5-ylmethyl)-formyl-amino]-1-(2-phosphonooxy-ethyl)-propenyl} ester |
| EINECS 205-788-1 |
| MFCD00036175 |