Phosphoric acid 2,2-dichloroethenylmethylphenyl ester structure
|
Common Name | Phosphoric acid 2,2-dichloroethenylmethylphenyl ester | ||
|---|---|---|---|---|
| CAS Number | 3309-70-4 | Molecular Weight | 233.88300 | |
| Density | 1.418g/cm3 | Boiling Point | 278.8ºC at 760 mmHg | |
| Molecular Formula | C6HCl4F | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.7ºC | |
| Name | 1,2,4,5-tetrachloro-3-fluorobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.418g/cm3 |
|---|---|
| Boiling Point | 278.8ºC at 760 mmHg |
| Molecular Formula | C6HCl4F |
| Molecular Weight | 233.88300 |
| Flash Point | 146.7ºC |
| Exact Mass | 231.88200 |
| LogP | 4.43930 |
| Index of Refraction | 1.535 |
| InChIKey | PTISDJVTCHQESX-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC=C(Cl)Cl)Oc1ccccc1 |
| HS Code | 2919900090 |
|---|
|
~%
Phosphoric acid... CAS#:3309-70-4 |
| Literature: Matschiner,H. et al. Journal fuer Praktische Chemie (Leipzig), 1977 , vol. 319, p. 561 - 567 |
|
~%
Phosphoric acid... CAS#:3309-70-4 |
| Literature: Matschiner,H. et al. Journal fuer Praktische Chemie (Leipzig), 1977 , vol. 319, p. 561 - 567 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Benzene,1,2,4,5-tetrachloro-3-fluoro |