1,5-DIIODO-9,10-ANTHRACENEDIONE structure
|
Common Name | 1,5-DIIODO-9,10-ANTHRACENEDIONE | ||
|---|---|---|---|---|
| CAS Number | 3311-73-7 | Molecular Weight | 460.00500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H6I2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5-diiodoanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H6I2O2 |
|---|---|
| Molecular Weight | 460.00500 |
| Exact Mass | 459.84600 |
| PSA | 34.14000 |
| LogP | 3.67120 |
| InChIKey | FLFAOOZAOSEZEB-UHFFFAOYSA-N |
| SMILES | O=C1c2cccc(I)c2C(=O)c2cccc(I)c21 |
| HS Code | 2914700090 |
|---|
|
~80%
1,5-DIIODO-9,10... CAS#:3311-73-7 |
| Literature: Kendall; Shechter Journal of Organic Chemistry, 2001 , vol. 66, # 20 p. 6643 - 6649 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1,5-diiodo-9,10-anthraquinone |
| 9,10-Anthracenedione,1,5-diiodo |
| 1,5-Diiodanthrachinon |
| 1,5-Dijod-anthrachinon |
| 1,5-diiodoanthraquinone |