1,5-Diaminoanthraquinone structure
|
Common Name | 1,5-Diaminoanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 129-44-2 | Molecular Weight | 238.241 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 551.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C14H10N2O2 | Melting Point | >300 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 287.6±30.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,5-Diaminoanthraquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 551.9±50.0 °C at 760 mmHg |
| Melting Point | >300 °C(lit.) |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.241 |
| Flash Point | 287.6±30.1 °C |
| Exact Mass | 238.074234 |
| PSA | 86.18000 |
| LogP | 3.32 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.757 |
| InChIKey | VWBVCOPVKXNMMZ-UHFFFAOYSA-N |
| SMILES | Nc1cccc2c1C(=O)c1cccc(N)c1C2=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | CB6400000 |
| HS Code | 2922399090 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Vertical organic nanowire arrays: controlled synthesis and chemical sensors.
J. Am. Chem. Soc. 131(9) , 3158-9, (2009) Vertical organic nanowire arrays of 1,5-diaminoanthraquinone (DAAQ) on solid substrates were prepared by a facile physical vapor transport method. The crystal structure and growth direction of the nan... |
|
|
Patterned growth of vertically aligned organic nanowire waveguide arrays.
ACS Nano 4(3) , 1630-6, (2010) Vertical nanowire arrays were prepared from an organic dye compound, 1,5-diaminoanthraquinone (DAAQ), on various types of substrates by a facile physical vapor transport method. It was found that the ... |
|
|
Productive synthesis and properties of polydiaminoanthraquinone and its pure self-stabilized nanoparticles with widely adjustable electroconductivity.
Chemistry 13(31) , 8884-96, (2007) Wholly aromatic poly(1,5-diaminoanthraquinone) (PDAA) particles were productively synthesized for the first time by chemically oxidative polymerization of 1,5-diaminoanthraquinone (DAA) by using CrO3,... |
| 1,5-Diamino-9,10-anthraquinone |
| 1,5-Diaminoanthraquinone |
| 1,5-Diamino-9,10-anthracenedione |
| MFCD00001226 |
| 1,5-Diaminoanthracene-9,10-dione |
| EINECS 204-947-2 |
| Anthraquinone, 1,5-diamino |