4-tert-Butylphenacylamine hydrochloride structure
|
Common Name | 4-tert-Butylphenacylamine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 33119-71-0 | Molecular Weight | 227.730 | |
| Density | N/A | Boiling Point | 344ºC at 760mmHg | |
| Molecular Formula | C12H18ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.8ºC | |
| Name | 2-amino-1-(4-tert-butylphenyl)ethanone,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 344ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.730 |
| Flash Point | 161.8ºC |
| Exact Mass | 227.107697 |
| PSA | 43.09000 |
| LogP | 3.62780 |
| InChIKey | UELSSNHDPBUPHO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(=O)CN)cc1.Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2922399090 |
|
~66%
4-tert-Butylphe... CAS#:33119-71-0 |
| Literature: Maeda; Suzuki; Iwasaki; Matsumoto; Iwasawa Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 7 p. 2536 - 2543 |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| OR2866 |
| 4-(tert-Butyl)phenacylamine hydrochloride |
| Ethanone,2-amino-1-[4-(1,1-dimethylethyl)phenyl]-,hydrochloride |
| 2-Amino-1-[4-(2-methyl-2-propanyl)phenyl]ethanone hydrochloride (1:1) |
| 2-Amino-4'-(tert-butyl)acetophenone hydrochloride |
| 2-Amino-4'-tert-butylacetophenone HCl |
| 2-amino-1-(4-tert-butylphenyl)ethanone hydrochloride |
| Ethanone, 2-amino-1-[4-(1,1-dimethylethyl)phenyl]-, hydrochloride (1:1) |