(Z)-Thiothixene structure
|
Common Name | (Z)-Thiothixene | ||
|---|---|---|---|---|
| CAS Number | 3313-26-6 | Molecular Weight | 443.62500 | |
| Density | 1.269 g/cm3 | Boiling Point | 599ºC at 760 mmHg | |
| Molecular Formula | C23H29N3O2S2 | Melting Point | 114-118ºC | |
| MSDS | N/A | Flash Point | 316.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of (Z)-Thiothixene(Z)-Thiothixene is an antagonist of serotonergic receptor extracted from patent US 20150141345 A1. |
| Name | cis-Thiothixene N,N-Dimethyl-9-[3-(4-methyl-1-piperazinyl)propylidene]thioxanthene-2-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Description | (Z)-Thiothixene is an antagonist of serotonergic receptor extracted from patent US 20150141345 A1. |
|---|---|
| Related Catalog | |
| Target |
serotonergic receptor[1] |
| In Vitro | (Z)-Thiothixene is capable of promoting cell survival and/or plasticity, and/or inhibiting cell death, especially when a toxic agent is exposed to the cells, including neuronal cells[1]. (Z)-Thiothixene is a Z (cis) isomer of thiothixene, as well as synthetic precursor and degradant[2]. |
| References |
[1]. Illana Gozes, et al. Novel compounds and methods for inhibiting cell death. US 20150141345 A1. |
| Density | 1.269 g/cm3 |
|---|---|
| Boiling Point | 599ºC at 760 mmHg |
| Melting Point | 114-118ºC |
| Molecular Formula | C23H29N3O2S2 |
| Molecular Weight | 443.62500 |
| Flash Point | 316.1ºC |
| Exact Mass | 443.17000 |
| PSA | 77.54000 |
| LogP | 4.42730 |
| Index of Refraction | 1.643 |
| InChIKey | GFBKORZTTCHDGY-UWVJOHFNSA-N |
| SMILES | CN1CCN(CCC=C2c3ccccc3Sc3ccc(S(=O)(=O)N(C)C)cc32)CC1 |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Precautionary Statements | P301 + P312 + P330 |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| RIDADR | NONH for all modes of transport |
| RTECS | XO1420000 |
| Thiothixene |
| MFCD00079574 |
| N,N-Dimethyl-9-[3-(4-methyl-1-piperazinyl)propylidene]thioxanthene-2-sulfonamide |
| cis-Thiothixene |
| (Z)-Thiothixene |