4,7,4'-trimethylallopsoralen structure
|
Common Name | 4,7,4'-trimethylallopsoralen | ||
|---|---|---|---|---|
| CAS Number | 33158-05-3 | Molecular Weight | 228.24300 | |
| Density | 1.236g/cm3 | Boiling Point | 397.3ºC at 760mmHg | |
| Molecular Formula | C14H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.1ºC | |
| Name | 2,4,9-trimethylfuro[2,3-f]chromen-7-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.236g/cm3 |
|---|---|
| Boiling Point | 397.3ºC at 760mmHg |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.24300 |
| Flash Point | 194.1ºC |
| Exact Mass | 228.07900 |
| PSA | 43.35000 |
| LogP | 3.46440 |
| Index of Refraction | 1.613 |
| InChIKey | IZLPACMKANNNGR-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(C)cc3oc(=O)cc(C)c3c2o1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4,9-Trimethylallopsoralen |
| 4,7,5'-Trimethyl-allopsoralen |
| 4,7,4'-Trimethylallopsoralen |