1,4-bis[(E)-2-nitroprop-1-enyl]benzene structure
|
Common Name | 1,4-bis[(E)-2-nitroprop-1-enyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 3316-23-2 | Molecular Weight | 248.23500 | |
| Density | 1.262g/cm3 | Boiling Point | 412.6ºC at 760 mmHg | |
| Molecular Formula | C12H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.6ºC | |
| Name | 1-[(Z)-2-nitroprop-1-enyl]-4-[(E)-2-nitroprop-1-enyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 412.6ºC at 760 mmHg |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.23500 |
| Flash Point | 198.6ºC |
| Exact Mass | 248.08000 |
| PSA | 91.64000 |
| LogP | 4.00800 |
| Index of Refraction | 1.628 |
| InChIKey | YDRFYIMGSXCFJK-FKJILZIQSA-N |
| SMILES | CC(=Cc1ccc(C=C(C)[N+](=O)[O-])cc1)[N+](=O)[O-] |
|
~%
1,4-bis[(E)-2-n... CAS#:3316-23-2 |
| Literature: Worrall Journal of the American Chemical Society, 1940 , vol. 62, p. 3253 |
|
~%
1,4-bis[(E)-2-n... CAS#:3316-23-2 |
| Literature: Worrall Journal of the American Chemical Society, 1940 , vol. 62, p. 3253 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,4-bis-(2-nitro-propenyl)-benzene |
| 1.4-Bis-(2-nitro-propenyl)-benzol |
| p-bis(2-nitropropenyl)-benzene |