Ethyl (3-fluorobenzoyl)acetate structure
|
Common Name | Ethyl (3-fluorobenzoyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 33166-77-7 | Molecular Weight | 210.202 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 275.1±15.0 °C at 760 mmHg | |
| Molecular Formula | C11H11FO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 116.5±15.3 °C | |
| Name | 3-(3-fluoro-phenyl)-3-oxo-propionic acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 275.1±15.0 °C at 760 mmHg |
| Molecular Formula | C11H11FO3 |
| Molecular Weight | 210.202 |
| Flash Point | 116.5±15.3 °C |
| Exact Mass | 210.069229 |
| PSA | 43.37000 |
| LogP | 1.97 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | MLABEWHVTXMKHP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1cccc(F)c1 |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| Hazard Codes | Xn |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~71%
Ethyl (3-fluoro... CAS#:33166-77-7 |
| Literature: Chen, Yi-Fong; Lin, Yi-Chien; Huang, Po-Kai; Chan, Hsu-Chin; Kuo, Sheng-Chu; Lee, Kuo-Hsiung; Huang, Li-Jiau Bioorganic and Medicinal Chemistry, 2013 , vol. 21, # 17 p. 5064 - 5075 |
|
~%
Ethyl (3-fluoro... CAS#:33166-77-7 |
| Literature: US2008/188521 A1, ; Page/Page column 19-20 ; |
|
~%
Ethyl (3-fluoro... CAS#:33166-77-7 |
| Literature: Organic Process Research and Development, , vol. 14, # 3 p. 592 - 599 |
|
~%
Ethyl (3-fluoro... CAS#:33166-77-7 |
| Literature: US2012/277224 A1, ; Page/Page column 28 ; US 20120277224 A1 |
|
~%
Ethyl (3-fluoro... CAS#:33166-77-7 |
| Literature: Organic Process Research and Development, , vol. 16, # 2 p. 214 - 219 |
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| MFCD03424809 |
| 3-(3-Fluorophenyl)-3-oxo-propionic acid ethyl |
| Ethyl (3-fluorobenzoyl)acetate |
| Ethyl 3-fluoro-β-oxobenzenepropanoate |
| Ethyl 3-(3-fluorophenyl)-3-oxopropanoate |
| FR CV1VO2 |
| Benzenepropanoic acid, 3-fluoro-β-oxo-, ethyl ester |