ethyl 3-oxo-3-m-tolylpropanoate structure
|
Common Name | ethyl 3-oxo-3-m-tolylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 33166-79-9 | Molecular Weight | 206.238 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 293.1±15.0 °C at 760 mmHg | |
| Molecular Formula | C12H14O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 125.4±20.4 °C | |
| Name | ethyl 3-(3-methylphenyl)-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 293.1±15.0 °C at 760 mmHg |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.238 |
| Flash Point | 125.4±20.4 °C |
| Exact Mass | 206.094299 |
| PSA | 43.37000 |
| LogP | 2.33 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.509 |
| InChIKey | LLFKVNDSLHMEQC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1cccc(C)c1 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918300090 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Name: Antagonist activity against quorum sensing system in Vibrio harveyi BB120 assessed as...
Source: ChEMBL
Target: N/A
External Id: CHEMBL5232507
|
| Ethyl (3-methylbenzoyl)acetate |
| 3-oxo-3-(3-methylphenyl)propionic acid ethyl ester |
| ethyl 3-oxo-3-m-tolylpropanoate |
| Ethyl 3-(3-methylphenyl)-3-oxopropanoate |
| 3-(3-methylphenyl)-3-oxopropionic acid ethyl ester |
| Ethyl m-toluoylacetate |
| ethyl m-methylbenzoylacetate |
| 3-Oxo-3-m-tolyl-propionic acid ethyl ester |
| MFCD03424816 |
| Benzenepropanoic acid, 3-methyl-β-oxo-, ethyl ester |