4-Hydroxy-5-methoxyquinoline- 3-carbonitrile structure
|
Common Name | 4-Hydroxy-5-methoxyquinoline- 3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 331662-64-7 | Molecular Weight | 200.19300 | |
| Density | 1.328g/cm3 | Boiling Point | 353.867ºC at 760 mmHg | |
| Molecular Formula | C11H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.813ºC | |
| Name | 5-methoxy-4-oxo-1H-quinoline-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.328g/cm3 |
|---|---|
| Boiling Point | 353.867ºC at 760 mmHg |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.19300 |
| Flash Point | 167.813ºC |
| Exact Mass | 200.05900 |
| PSA | 65.88000 |
| LogP | 1.40838 |
| Index of Refraction | 1.621 |
| InChIKey | FBZWGJLDVKSZDW-UHFFFAOYSA-N |
| SMILES | COc1cccc2[nH]cc(C#N)c(=O)c12 |
| HS Code | 2933499090 |
|---|
|
~%
4-Hydroxy-5-met... CAS#:331662-64-7 |
| Literature: Boschelli; Wang; Ye; Wu; Zhang; Dutia; Powell; Wissner; Arndt; Weber Journal of Medicinal Chemistry, 2001 , vol. 44, # 5 p. 822 - 833 |
|
~%
4-Hydroxy-5-met... CAS#:331662-64-7 |
| Literature: Zhang, Nan; Wu, Biqi; Powell, Dennis; Wissner, Allan; B. Floyd, Middleton; D. Kovacs, Eleonora; Toral-Barza, Lourdes; Kohler, Constance Bioorganic and Medicinal Chemistry Letters, 2000 , vol. 10, # 24 p. 2825 - 2828 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-hydroxy-5-methoxy-3-quinolinecarbonitrile |
| 4-HYDROXY-5-METHOXYQUINOLINE-3-CARBONITRILE |
| 3-Quinolinecarbonitrile,1,4-dihydro-5-methoxy-4-oxo |