4-Chloro-5-methoxy-3-quinolinecarbonitrile structure
|
Common Name | 4-Chloro-5-methoxy-3-quinolinecarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 331662-72-7 | Molecular Weight | 218.63900 | |
| Density | 1.361g/cm3 | Boiling Point | 385.306ºC at 760 mmHg | |
| Molecular Formula | C11H7ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.827ºC | |
| Name | 4-Chloro-5-methoxy-3-quinolinecarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.361g/cm3 |
|---|---|
| Boiling Point | 385.306ºC at 760 mmHg |
| Molecular Formula | C11H7ClN2O |
| Molecular Weight | 218.63900 |
| Flash Point | 186.827ºC |
| Exact Mass | 218.02500 |
| PSA | 45.91000 |
| LogP | 2.76848 |
| Index of Refraction | 1.64 |
| InChIKey | UJGRRVNELFZUBY-UHFFFAOYSA-N |
| SMILES | COc1cccc2ncc(C#N)c(Cl)c12 |
|
~%
4-Chloro-5-meth... CAS#:331662-72-7 |
| Literature: Boschelli; Wang; Ye; Wu; Zhang; Dutia; Powell; Wissner; Arndt; Weber Journal of Medicinal Chemistry, 2001 , vol. 44, # 5 p. 822 - 833 |
|
~%
4-Chloro-5-meth... CAS#:331662-72-7 |
| Literature: Boschelli; Wang; Ye; Wu; Zhang; Dutia; Powell; Wissner; Arndt; Weber Journal of Medicinal Chemistry, 2001 , vol. 44, # 5 p. 822 - 833 |
|
~%
4-Chloro-5-meth... CAS#:331662-72-7 |
| Literature: Zhang, Nan; Wu, Biqi; Powell, Dennis; Wissner, Allan; B. Floyd, Middleton; D. Kovacs, Eleonora; Toral-Barza, Lourdes; Kohler, Constance Bioorganic and Medicinal Chemistry Letters, 2000 , vol. 10, # 24 p. 2825 - 2828 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4'-chloro-5-methoxy-3-biphenylylacetic acid |
| 4'-Chloro-5-methoxy-3-biphenylacetic acid |
| 3-BIPHENYLACETIC ACID,4'-CHLORO-5-METHOXY |
| DKA 9 |