(R)-FMOC-4-FLUORO-BETA-HOMOPHE-OH structure
|
Common Name | (R)-FMOC-4-FLUORO-BETA-HOMOPHE-OH | ||
|---|---|---|---|---|
| CAS Number | 331763-70-3 | Molecular Weight | 419.44500 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 636.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C25H22FNO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(4-fluorophenyl)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 636.9±55.0 °C at 760 mmHg |
| Molecular Formula | C25H22FNO4 |
| Molecular Weight | 419.44500 |
| Exact Mass | 419.15300 |
| PSA | 75.63000 |
| LogP | 5.14110 |
| InChIKey | LTBGWPINKRNSDL-GOSISDBHSA-N |
| SMILES | O=C(O)CC(Cc1ccc(F)cc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2-8°C |
| Safety Phrases | S22;S24/25 |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD01860915 |
| (3R)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-(4-fluorophenyl)butanoic acid |
| (R)-3-(Fmoc-amino)-4-(4-fluorophenyl)butyric acid |