2,4-Decanedione,1,1,1-trifluoro- structure
|
Common Name | 2,4-Decanedione,1,1,1-trifluoro- | ||
|---|---|---|---|---|
| CAS Number | 332-82-1 | Molecular Weight | 224.22000 | |
| Density | 1.097g/cm3 | Boiling Point | 231.1ºC at 760mmHg | |
| Molecular Formula | C10H15F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 78ºC | |
| Name | 1,1,1-trifluorodecane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.097g/cm3 |
|---|---|
| Boiling Point | 231.1ºC at 760mmHg |
| Molecular Formula | C10H15F3O2 |
| Molecular Weight | 224.22000 |
| Flash Point | 78ºC |
| Exact Mass | 224.10200 |
| PSA | 34.14000 |
| LogP | 3.04740 |
| Index of Refraction | 1.394 |
| InChIKey | UVLGAJSKYICIQF-UHFFFAOYSA-N |
| SMILES | CCCCCCC(=O)CC(=O)C(F)(F)F |
| HS Code | 2914700090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1,1,1-Trifluor-decan-2,4-dion |
| 1,1,1-trifluoro-2,4-decanedione |
| 1,1,1-trifluoro-decane-2,4-dione |