2,4-Heptanedione,1,1,1-trifluoro-6-methyl- structure
|
Common Name | 2,4-Heptanedione,1,1,1-trifluoro-6-methyl- | ||
|---|---|---|---|---|
| CAS Number | 461-92-7 | Molecular Weight | 196.16700 | |
| Density | 1.143g/cm3 | Boiling Point | 183.6ºC at 760mmHg | |
| Molecular Formula | C8H11F3O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 57.4ºC | |
| Name | 1,1,1-trifluoro-6-methylheptane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 183.6ºC at 760mmHg |
| Molecular Formula | C8H11F3O2 |
| Molecular Weight | 196.16700 |
| Flash Point | 57.4ºC |
| Exact Mass | 196.07100 |
| PSA | 34.14000 |
| LogP | 2.12310 |
| Vapour Pressure | 0.766mmHg at 25°C |
| Index of Refraction | 1.378 |
| InChIKey | XWBVTGFPQXBNOZ-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)CC(=O)C(F)(F)F |
| Hazard Codes | F+ |
|---|---|
| HS Code | 2914700090 |
|
~%
2,4-Heptanedion... CAS#:461-92-7 |
| Literature: Reid; Calvin Journal of the American Chemical Society, 1950 , vol. 72, p. 2948,2949 |
|
~20%
2,4-Heptanedion... CAS#:461-92-7 |
| Literature: Simunek, Petr; Svobodova, Marketa; Machacek, Vladimir Journal of Heterocyclic Chemistry, 2009 , vol. 46, # 4 p. 650 - 655 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Isovaleryltrifluoroacetone |
| 6-methyl-1,1,1-trifluoro-2,4-heptanedione |
| TOS-BB-0656 |
| 1,1,1-Trifluor-6-methyl-heptan-2,4-dion |
| Trifluoroacetylisovalerylmethane |
| 1,1,1-trifluoro-6-methyl-heptane-2,4-dione |