(R)-Dragonfly N-Trifluoroacetamide
(R)-Dragonfly N-Trifluoroacetamide structure
|
Common Name | (R)-Dragonfly N-Trifluoroacetamide | ||
|---|---|---|---|---|
| CAS Number | 332012-06-3 | Molecular Weight | 311.25600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (R)-Dragonfly N-Trifluoroacetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H12F3NO3 |
|---|---|
| Molecular Weight | 311.25600 |
| Exact Mass | 311.07700 |
| PSA | 58.87000 |
| LogP | 4.62880 |
| InChIKey | WQFRAEFKSDEAJF-MRVPVSSYSA-N |
| SMILES | CC(Cc1c2ccoc2cc2ccoc12)NC(=O)C(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![(R)-(+)-N-trifluoroacetyl-1-(2,3,6,7-tetrahydrobenzo[1,2-b,4,5-b']difuran-4-yl)-2-aminopropane structure](https://image.chemsrc.com/caspic/054/332012-04-1.png)
![Benzo[1,2-b:4,5-b']difuran,2,3,6,7-tetrahydro structure](https://image.chemsrc.com/caspic/487/81926-24-1.png)
![(R)-(+)-N-trifluoroacetyl-2,3,6,7-tetrahydro-4-alanylbenzo[1,2-b,4,5-b']difuran structure](https://image.chemsrc.com/caspic/140/332012-02-9.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,2,2-Trifluoro-N-[(2S)-1-(furo[2,3-f][1]benzofuran-4-yl)-2-propa nyl]acetamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does (R)-Dragonfly N-Trifluoroacetamide have? |
| A: English synonyms of (R)-Dragonfly N-Trifluoroacetamide: 2,2,2-Trifluoro-N-[(2S)-1-(furo[2,3-f][1]benzofuran-4-yl)-2-propa nyl]acetamide. |
| Q: What is the polar surface area (PSA) of (R)-Dragonfly N-Trifluoroacetamide? |
| A: Polar surface area (PSA) of (R)-Dragonfly N-Trifluoroacetamide is 58.87000. |
| Q: What is the molecular formula of (R)-Dragonfly N-Trifluoroacetamide? |
| A: Molecular formula of (R)-Dragonfly N-Trifluoroacetamide is C15H12F3NO3. |
| Q: What is the Chinese name of 332012-06-3? |
| A: Chinese name of 332012-06-3 is 332012-06-3. |
| Q: What is the CAS number of (R)-Dragonfly N-Trifluoroacetamide? |
| A: CAS number of (R)-Dragonfly N-Trifluoroacetamide is 332012-06-3. |
| Q: What is the LogP of (R)-Dragonfly N-Trifluoroacetamide? |
| A: LogP of (R)-Dragonfly N-Trifluoroacetamide is 4.62880. |
| Q: What is the InChIKey of (R)-Dragonfly N-Trifluoroacetamide? |
| A: InChIKey of (R)-Dragonfly N-Trifluoroacetamide is WQFRAEFKSDEAJF-MRVPVSSYSA-N. |
| Q: What is the English name of (R)-Dragonfly N-Trifluoroacetamide? |
| A: The English name of (R)-Dragonfly N-Trifluoroacetamide is (R)-Dragonfly N-Trifluoroacetamide. |
| Q: What is the molecular weight of (R)-Dragonfly N-Trifluoroacetamide? |
| A: Molecular weight of (R)-Dragonfly N-Trifluoroacetamide is 311.25600. |
| Q: What is the SMILES notation of (R)-Dragonfly N-Trifluoroacetamide? |
| A: SMILES notation of (R)-Dragonfly N-Trifluoroacetamide is CC(Cc1c2ccoc2cc2ccoc12)NC(=O)C(F)(F)F. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |