fmoc-(r)-3-amino-(6-phenyl)-5-hexenoic acid
Modify Date: 2026-08-04 14:22:07
fmoc-(r)-3-amino-(6-phenyl)-5-hexenoic acid structure
|
Common Name | fmoc-(r)-3-amino-(6-phenyl)-5-hexenoic acid | ||
|---|---|---|---|---|
| CAS Number | 332064-75-2 | Molecular Weight | 427.492 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 694.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C27H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 373.8±31.5 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 694.5±55.0 °C at 760 mmHg |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.492 |
| Flash Point | 373.8±31.5 °C |
| Exact Mass | 427.178345 |
| PSA | 75.63000 |
| LogP | 5.97 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | MLWHGLZHUJARIA-OJLWIZQOSA-N |
| SMILES | O=C(O)CC(CC=Cc1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2-8°C |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| FMOC-D-PHE(NO 5,6-CH)-(C*CH2)OH |
| FMOC-(R)-3-AMINO-(6-PHENYL)-5-HEXENOICACID |
| Fmoc-D-b-HoAla(styryl)-OH |
| RARECHEM AK PT F006 |
| 5-Hexenoic acid,3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-6-phenyl-,(3R) |
| N-(9-FLUORENYLMETHOXYCARBONYL)-(R)-3-AMINO-(6-PHENYL)-5-HEXENOIC ACID |
| (3R,5E)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-6-phenyl-5-hexenoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid? |
| A: Boiling point of (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid is 694.5±55.0 °C at 760 mmHg. |
| Q: What is the CAS number of (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid? |
| A: CAS number of (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid is 332064-75-2. |
| Q: What is the safety information for (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid? |
| A: Safety information for (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid: 45. |
| Q: What is the molecular weight of (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid? |
| A: Molecular weight of (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid is 427.492. |
| Q: What is the InChIKey of (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid? |
| A: InChIKey of (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid is MLWHGLZHUJARIA-OJLWIZQOSA-N. |
| Q: What is the LogP of (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid? |
| A: LogP of (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid is 5.97. |
| Q: What English synonyms does (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid have? |
| A: English synonyms of (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid: FMOC-D-PHE(NO 5,6-CH)-(C*CH2)OH, FMOC-(R)-3-AMINO-(6-PHENYL)-5-HEXENOICACID, Fmoc-D-b-HoAla(styryl)-OH, RARECHEM AK PT F006, 5-Hexenoic acid,3-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-6-phenyl-,(3R), N-(9-FLUORENYLMETHOXYCARBONYL)-(R)-3-AMINO-(6-PHENYL)-5-HEXENOIC ACID, (3R,5E)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-6-phenyl-5-hexenoic acid. |
| Q: What is the molecular formula of (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid? |
| A: Molecular formula of (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid is C27H25NO4. |
| Q: What is the polar surface area (PSA) of (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid? |
| A: Polar surface area (PSA) of (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid is 75.63000. |
| Q: What is the SMILES notation of (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid? |
| A: SMILES notation of (2R)-3-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)-6-phenylhex-5-enoic acid is O=C(O)CC(CC=Cc1ccccc1)NC(=O)OCC1c2ccccc2-c2ccccc21. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |