WAY-321539 structure
|
Common Name | WAY-321539 | ||
|---|---|---|---|---|
| CAS Number | 332074-13-2 | Molecular Weight | 297.3119 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 558.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C15H15N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.8±27.9 °C | |
Use of WAY-321539inhibitors of the STAT3 pathway |
| Name | WAY-321539 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 558.9±42.0 °C at 760 mmHg |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.3119 |
| Flash Point | 291.8±27.9 °C |
| Exact Mass | 297.122589 |
| LogP | 1.32 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.684 |
| InChIKey | JGBVKLZKXUSJRA-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(C)nc(Nc3nc(C)cc(=O)[nH]3)nc2c1 |
| 2-[(7-methoxy-4-methylquinazolin-2-yl)amino]-6-methylpyrimidin-4-ol |
| 4(1H)-Pyrimidinone, 2-[(7-methoxy-4-methyl-2-quinazolinyl)amino]-6-methyl- |
| 2-[(7-Methoxy-4-methyl-2-quinazolinyl)amino]-6-methyl-4(1H)-pyrimidinone |